C14H20F2N2O — CID 107206627
N-(5-aminopentyl)-2,4-difluoro-N,5-dimethylbenzamide (PubChem CID 107206627) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is N-(5-aminopentyl)-2,4-difluoro-N,5-dimethylbenzamide.
| Compound Name | N-(5-aminopentyl)-2,4-difluoro-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 107206627 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-(5-aminopentyl)-2,4-difluoro-N,5-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)N(C)CCCCCN)c(F)cc1F |
| InChI | InChI=1S/C14H20F2N2O/c1-10-8-11(13(16)9-12(10)15)14(19)18(2)7-5-3-4-6-17/h8-9H,3-7,17H2,1-2H3 |
| InChIKey | YTDFLJCLHZEQIS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|