C12H16ClFN2O — CID 117045005
N-(3-aminopropyl)-2-chloro-5-fluoro-N,4-dimethylbenzamide (PubChem CID 117045005) has the molecular formula C12H16ClFN2O and a molecular weight of 258.72 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-chloro-5-fluoro-N,4-dimethylbenzamide.
| Compound Name | N-(3-aminopropyl)-2-chloro-5-fluoro-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 117045005 |
| Molecular Formula | C12H16ClFN2O |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N-(3-aminopropyl)-2-chloro-5-fluoro-N,4-dimethylbenzamide |
| SMILES | Cc1cc(Cl)c(C(=O)N(C)CCCN)cc1F |
| InChI | InChI=1S/C12H16ClFN2O/c1-8-6-10(13)9(7-11(8)14)12(17)16(2)5-3-4-15/h6-7H,3-5,15H2,1-2H3 |
| InChIKey | CYHBFTSCUGNOOI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |