C10H12ClFN2O — CID 119382876
N-(2-aminoethyl)-2-chloro-4-fluoro-5-methylbenzamide (PubChem CID 119382876) has the molecular formula C10H12ClFN2O and a molecular weight of 230.67 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-chloro-4-fluoro-5-methylbenzamide.
| Compound Name | N-(2-aminoethyl)-2-chloro-4-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 119382876 |
| Molecular Formula | C10H12ClFN2O |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | N-(2-aminoethyl)-2-chloro-4-fluoro-5-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCCN)c(Cl)cc1F |
| InChI | InChI=1S/C10H12ClFN2O/c1-6-4-7(8(11)5-9(6)12)10(15)14-3-2-13/h4-5H,2-3,13H2,1H3,(H,14,15) |
| InChIKey | WOBPTSBICPTYLU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |