C9H9ClFNO — CID 116827653
2-chloro-5-fluoro-N,4-dimethylbenzamide (PubChem CID 116827653) has the molecular formula C9H9ClFNO and a molecular weight of 201.63 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N,4-dimethylbenzamide.
| Compound Name | 2-chloro-5-fluoro-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 116827653 |
| Molecular Formula | C9H9ClFNO |
| Molecular Weight | 201.63 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-chloro-5-fluoro-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1cc(F)c(C)cc1Cl |
| InChI | InChI=1S/C9H9ClFNO/c1-5-3-7(10)6(4-8(5)11)9(13)12-2/h3-4H,1-2H3,(H,12,13) |
| InChIKey | NSGLLPSBRQXLTB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.63 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |