C11H15ClN2O — CID 82883577
N-(3-aminopropyl)-5-chloro-2-methylbenzamide (PubChem CID 82883577) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-chloro-2-methylbenzamide.
| Compound Name | N-(3-aminopropyl)-5-chloro-2-methylbenzamide |
|---|---|
| PubChem CID | 82883577 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-(3-aminopropyl)-5-chloro-2-methylbenzamide |
| SMILES | Cc1ccc(Cl)cc1C(=O)NCCCN |
| InChI | InChI=1S/C11H15ClN2O/c1-8-3-4-9(12)7-10(8)11(15)14-6-2-5-13/h3-4,7H,2,5-6,13H2,1H3,(H,14,15) |
| InChIKey | AAXCXYIWHVQAGG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|