C11H16N2O2 — CID 107670534
N-(3-aminopropyl)-4-hydroxy-2-methylbenzamide (PubChem CID 107670534) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-hydroxy-2-methylbenzamide.
| Compound Name | N-(3-aminopropyl)-4-hydroxy-2-methylbenzamide |
|---|---|
| PubChem CID | 107670534 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-(3-aminopropyl)-4-hydroxy-2-methylbenzamide |
| SMILES | Cc1cc(O)ccc1C(=O)NCCCN |
| InChI | InChI=1S/C11H16N2O2/c1-8-7-9(14)3-4-10(8)11(15)13-6-2-5-12/h3-4,7,14H,2,5-6,12H2,1H3,(H,13,15) |
| InChIKey | ULGQZEFYBNGHBM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|