C20H37N5O3 — CID 101205069
N-[3-[3-[4-(3-aminopropylamino)butylamino]propylamino]propyl]-2,5-dihydroxybenzamide (PubChem CID 101205069) has the molecular formula C20H37N5O3 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[3-[3-[4-(3-aminopropylamino)butylamino]propylamino]propyl]-2,5-dihydroxybenzamide.
| Compound Name | N-[3-[3-[4-(3-aminopropylamino)butylamino]propylamino]propyl]-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 101205069 |
| Molecular Formula | C20H37N5O3 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | N-[3-[3-[4-(3-aminopropylamino)butylamino]propylamino]propyl]-2,5-dihydroxybenzamide |
| SMILES | NCCCNCCCCNCCCNCCCNC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C20H37N5O3/c21-8-3-11-22-9-1-2-10-23-12-4-13-24-14-5-15-25-20(28)18-16-17(26)6-7-19(18)27/h6-7,16,22-24,26-27H,1-5,8-15,21H2,(H,25,28) |
| InChIKey | NLFAQPALVYDJMB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 131.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|