C10H13BrN2O2 — CID 104872204
N-(3-aminopropyl)-5-bromo-2-hydroxybenzamide (PubChem CID 104872204) has the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-bromo-2-hydroxybenzamide.
| Compound Name | N-(3-aminopropyl)-5-bromo-2-hydroxybenzamide |
|---|---|
| PubChem CID | 104872204 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | N-(3-aminopropyl)-5-bromo-2-hydroxybenzamide |
| SMILES | NCCCNC(=O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C10H13BrN2O2/c11-7-2-3-9(14)8(6-7)10(15)13-5-1-4-12/h2-3,6,14H,1,4-5,12H2,(H,13,15) |
| InChIKey | IBKBGFSZOOKBLO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|