C14H13BrN2O2 — CID 107729215
N-[(4-aminophenyl)methyl]-5-bromo-2-hydroxybenzamide (PubChem CID 107729215) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-5-bromo-2-hydroxybenzamide.
| Compound Name | N-[(4-aminophenyl)methyl]-5-bromo-2-hydroxybenzamide |
|---|---|
| PubChem CID | 107729215 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-5-bromo-2-hydroxybenzamide |
| SMILES | Nc1ccc(CNC(=O)c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C14H13BrN2O2/c15-10-3-6-13(18)12(7-10)14(19)17-8-9-1-4-11(16)5-2-9/h1-7,18H,8,16H2,(H,17,19) |
| InChIKey | IIJCAFOCMMZEJE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|