C11H10BrNO2 — CID 103871171
5-bromo-N-but-2-ynyl-2-hydroxybenzamide (PubChem CID 103871171) has the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 5-bromo-N-but-2-ynyl-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-but-2-ynyl-2-hydroxybenzamide |
|---|---|
| PubChem CID | 103871171 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 5-bromo-N-but-2-ynyl-2-hydroxybenzamide |
| SMILES | CC#CCNC(=O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C11H10BrNO2/c1-2-3-6-13-11(15)9-7-8(12)4-5-10(9)14/h4-5,7,14H,6H2,1H3,(H,13,15) |
| InChIKey | NFTFXDFQMAZFBX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|