C11H11NO3 — CID 103957730
N-but-2-ynyl-3,4-dihydroxybenzamide (PubChem CID 103957730) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is N-but-2-ynyl-3,4-dihydroxybenzamide.
| Compound Name | N-but-2-ynyl-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 103957730 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | N-but-2-ynyl-3,4-dihydroxybenzamide |
| SMILES | CC#CCNC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H11NO3/c1-2-3-6-12-11(15)8-4-5-9(13)10(14)7-8/h4-5,7,13-14H,6H2,1H3,(H,12,15) |
| InChIKey | IENRSBRGDUGPGK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|