C16H25NO7 — CID 177473805
3,4-dihydroxy-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]benzamide (PubChem CID 177473805) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3,4-dihydroxy-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 3,4-dihydroxy-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 177473805 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3,4-dihydroxy-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]benzamide |
| SMILES | COCCOCCOCCOCCNC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H25NO7/c1-21-6-7-23-10-11-24-9-8-22-5-4-17-16(20)13-2-3-14(18)15(19)12-13/h2-3,12,18-19H,4-11H2,1H3,(H,17,20) |
| InChIKey | VZNLGRAIAIHEIE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|