C8H9NO4 — CID 103956380
3,4-dihydroxy-N-methoxybenzamide (PubChem CID 103956380) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 3,4-dihydroxy-N-methoxybenzamide.
| Compound Name | 3,4-dihydroxy-N-methoxybenzamide |
|---|---|
| PubChem CID | 103956380 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 3,4-dihydroxy-N-methoxybenzamide |
| SMILES | CONC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H9NO4/c1-13-9-8(12)5-2-3-6(10)7(11)4-5/h2-4,10-11H,1H3,(H,9,12) |
| InChIKey | ICYQDSLFWUGBMX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|