C13H18N2O5 — CID 103956666
3,4-dihydroxy-N-[3-(2-methoxyethylamino)-3-oxopropyl]benzamide (PubChem CID 103956666) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3,4-dihydroxy-N-[3-(2-methoxyethylamino)-3-oxopropyl]benzamide.
| Compound Name | 3,4-dihydroxy-N-[3-(2-methoxyethylamino)-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 103956666 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3,4-dihydroxy-N-[3-(2-methoxyethylamino)-3-oxopropyl]benzamide |
| SMILES | COCCNC(=O)CCNC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H18N2O5/c1-20-7-6-14-12(18)4-5-15-13(19)9-2-3-10(16)11(17)8-9/h2-3,8,16-17H,4-7H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | YWNNKNIJLHQMAE-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|