C12H15Cl2N3O3 — CID 115590920
5,6-dichloro-N-[3-(2-methoxyethylamino)-3-oxopropyl]pyridine-3-carboxamide (PubChem CID 115590920) has the molecular formula C12H15Cl2N3O3 and a molecular weight of 320.18 g/mol. Its IUPAC name is 5,6-dichloro-N-[3-(2-methoxyethylamino)-3-oxopropyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[3-(2-methoxyethylamino)-3-oxopropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115590920 |
| Molecular Formula | C12H15Cl2N3O3 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 5,6-dichloro-N-[3-(2-methoxyethylamino)-3-oxopropyl]pyridine-3-carboxamide |
| SMILES | COCCNC(=O)CCNC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O3/c1-20-5-4-15-10(18)2-3-16-12(19)8-6-9(13)11(14)17-7-8/h6-7H,2-5H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | IWGLRPMMARDMDZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|