C11H14Cl3N3O2 — CID 102751815
N-(2-methoxyethyl)-3-[(3,5,6-trichloro-2-pyridinyl)amino]propanamide (PubChem CID 102751815) has the molecular formula C11H14Cl3N3O2 and a molecular weight of 326.61 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[(3,5,6-trichloro-2-pyridinyl)amino]propanamide.
| Compound Name | N-(2-methoxyethyl)-3-[(3,5,6-trichloro-2-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 102751815 |
| Molecular Formula | C11H14Cl3N3O2 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | N-(2-methoxyethyl)-3-[(3,5,6-trichloro-2-pyridinyl)amino]propanamide |
| SMILES | COCCNC(=O)CCNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3N3O2/c1-19-5-4-15-9(18)2-3-16-11-8(13)6-7(12)10(14)17-11/h6H,2-5H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | LNGQRDTXMNVNSB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|