C12H16Cl2N2O2 — CID 109015130
3-(3,4-dichloroanilino)-N-(2-methoxyethyl)propanamide (PubChem CID 109015130) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 3-(3,4-dichloroanilino)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(3,4-dichloroanilino)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 109015130 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-(3,4-dichloroanilino)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O2/c1-18-7-6-16-12(17)4-5-15-9-2-3-10(13)11(14)8-9/h2-3,8,15H,4-7H2,1H3,(H,16,17) |
| InChIKey | NSGMOUHALYFFCS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|