C17H17Cl2FN2O — CID 109024765
3-(3,4-dichloroanilino)-N-[2-(2-fluorophenyl)ethyl]propanamide (PubChem CID 109024765) has the molecular formula C17H17Cl2FN2O and a molecular weight of 355.24 g/mol. Its IUPAC name is 3-(3,4-dichloroanilino)-N-[2-(2-fluorophenyl)ethyl]propanamide.
| Compound Name | 3-(3,4-dichloroanilino)-N-[2-(2-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 109024765 |
| Molecular Formula | C17H17Cl2FN2O |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-(3,4-dichloroanilino)-N-[2-(2-fluorophenyl)ethyl]propanamide |
| SMILES | O=C(CCNc1ccc(Cl)c(Cl)c1)NCCc1ccccc1F |
| InChI | InChI=1S/C17H17Cl2FN2O/c18-14-6-5-13(11-15(14)19)21-10-8-17(23)22-9-7-12-3-1-2-4-16(12)20/h1-6,11,21H,7-10H2,(H,22,23) |
| InChIKey | XCYTVYWIIOISTC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |