C18H19ClFNO — CID 46679807
3-(3-chloro-4-methylphenyl)-N-[2-(2-fluorophenyl)ethyl]propanamide (PubChem CID 46679807) has the molecular formula C18H19ClFNO and a molecular weight of 319.81 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-N-[2-(2-fluorophenyl)ethyl]propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-N-[2-(2-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 46679807 |
| Molecular Formula | C18H19ClFNO |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-N-[2-(2-fluorophenyl)ethyl]propanamide |
| SMILES | Cc1ccc(CCC(=O)NCCc2ccccc2F)cc1Cl |
| InChI | InChI=1S/C18H19ClFNO/c1-13-6-7-14(12-16(13)19)8-9-18(22)21-11-10-15-4-2-3-5-17(15)20/h2-7,12H,8-11H2,1H3,(H,21,22) |
| InChIKey | UNKUHPASRYMACD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |