C19H22ClFN2O3 — CID 109024771
3-(4-chloro-2,5-dimethoxyanilino)-N-[2-(2-fluorophenyl)ethyl]propanamide (PubChem CID 109024771) has the molecular formula C19H22ClFN2O3 and a molecular weight of 380.85 g/mol. Its IUPAC name is 3-(4-chloro-2,5-dimethoxyanilino)-N-[2-(2-fluorophenyl)ethyl]propanamide.
| Compound Name | 3-(4-chloro-2,5-dimethoxyanilino)-N-[2-(2-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 109024771 |
| Molecular Formula | C19H22ClFN2O3 |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-(4-chloro-2,5-dimethoxyanilino)-N-[2-(2-fluorophenyl)ethyl]propanamide |
| SMILES | COc1cc(NCCC(=O)NCCc2ccccc2F)c(OC)cc1Cl |
| InChI | InChI=1S/C19H22ClFN2O3/c1-25-17-12-16(18(26-2)11-14(17)20)22-10-8-19(24)23-9-7-13-5-3-4-6-15(13)21/h3-6,11-12,22H,7-10H2,1-2H3,(H,23,24) |
| InChIKey | LMOSBNXXBQAVMU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |