C18H21ClN2O4 — CID 109039398
3-(4-chloro-2,5-dimethoxyanilino)-N-(2-methoxyphenyl)propanamide (PubChem CID 109039398) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is 3-(4-chloro-2,5-dimethoxyanilino)-N-(2-methoxyphenyl)propanamide.
| Compound Name | 3-(4-chloro-2,5-dimethoxyanilino)-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 109039398 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-(4-chloro-2,5-dimethoxyanilino)-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1cc(NCCC(=O)Nc2ccccc2OC)c(OC)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O4/c1-23-15-7-5-4-6-13(15)21-18(22)8-9-20-14-11-16(24-2)12(19)10-17(14)25-3/h4-7,10-11,20H,8-9H2,1-3H3,(H,21,22) |
| InChIKey | MMFREMBLTBIXIO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |