About 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol
4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol (PubChem CID 114165086) has the molecular formula C11H15Cl3N2O2
and a molecular weight of 313.61 g/mol. Its IUPAC name is 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol.
Molecular Properties
| Compound Name | 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol |
| PubChem CID | 114165086 |
| Molecular Formula | C11H15Cl3N2O2 |
| Molecular Weight | 313.61 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol |
| SMILES | COCCC(C)(O)CNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl3N2O2/c1-11(17,3-4-18-2)6-15-10-8(13)5-7(12)9(14)16-10/h5,17H,3-4,6H2,1-2H3,(H,15,16) |
| InChIKey | ZNCDUQLKTRHDKC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol?
The IUPAC name of 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol (CID 114165086) is 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol.
What is the SMILES notation for 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol?
The canonical SMILES for 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol is COCCC(C)(O)CNc1nc(Cl)c(Cl)cc1Cl.
What is the InChIKey of 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol?
The InChIKey is ZNCDUQLKTRHDKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl3N2O2/c1-11(17,3-4-18-2)6-15-10-8(13)5-7(12)9(14)16-10/h5,17H,3-4,6H2,1-2H3,(H,15,16).
What are the key properties of 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol?
4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol has a molecular weight of 313.61 g/mol, XLogP of 3.24, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol is sourced from PubChem (CID 114165086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).