C11H15Cl3N2O2 — CID 114165086
4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol (PubChem CID 114165086) has the molecular formula C11H15Cl3N2O2 and a molecular weight of 313.61 g/mol. Its IUPAC name is 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol.
| Compound Name | 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 114165086 |
| Molecular Formula | C11H15Cl3N2O2 |
| Molecular Weight | 313.61 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 4-methoxy-2-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol |
| SMILES | COCCC(C)(O)CNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl3N2O2/c1-11(17,3-4-18-2)6-15-10-8(13)5-7(12)9(14)16-10/h5,17H,3-4,6H2,1-2H3,(H,15,16) |
| InChIKey | ZNCDUQLKTRHDKC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|