C14H21Cl3N2 — CID 102751554
3,5,6-trichloro-N-(2,2-dimethylheptyl)pyridin-2-amine (PubChem CID 102751554) has the molecular formula C14H21Cl3N2 and a molecular weight of 323.70 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(2,2-dimethylheptyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(2,2-dimethylheptyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751554 |
| Molecular Formula | C14H21Cl3N2 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3,5,6-trichloro-N-(2,2-dimethylheptyl)pyridin-2-amine |
| SMILES | CCCCCC(C)(C)CNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H21Cl3N2/c1-4-5-6-7-14(2,3)9-18-13-11(16)8-10(15)12(17)19-13/h8H,4-7,9H2,1-3H3,(H,18,19) |
| InChIKey | FVKZUJPGUCUYBT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|