C12H17Cl3N2 — CID 102751738
3,5,6-trichloro-N-(2,3,3-trimethylbutyl)pyridin-2-amine (PubChem CID 102751738) has the molecular formula C12H17Cl3N2 and a molecular weight of 295.64 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(2,3,3-trimethylbutyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(2,3,3-trimethylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751738 |
| Molecular Formula | C12H17Cl3N2 |
| Molecular Weight | 295.64 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 3,5,6-trichloro-N-(2,3,3-trimethylbutyl)pyridin-2-amine |
| SMILES | CC(CNc1nc(Cl)c(Cl)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C12H17Cl3N2/c1-7(12(2,3)4)6-16-11-9(14)5-8(13)10(15)17-11/h5,7H,6H2,1-4H3,(H,16,17) |
| InChIKey | XBBMHHZNPUJHMY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|