C10H13Cl3N2O — CID 102751939
3-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol (PubChem CID 102751939) has the molecular formula C10H13Cl3N2O and a molecular weight of 283.59 g/mol. Its IUPAC name is 3-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol.
| Compound Name | 3-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 102751939 |
| Molecular Formula | C10H13Cl3N2O |
| Molecular Weight | 283.59 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 3-methyl-1-[(3,5,6-trichloro-2-pyridinyl)amino]butan-2-ol |
| SMILES | CC(C)C(O)CNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl3N2O/c1-5(2)8(16)4-14-10-7(12)3-6(11)9(13)15-10/h3,5,8,16H,4H2,1-2H3,(H,14,15) |
| InChIKey | SNWPCDQLZBDPLH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|