C10H13Cl3N2S — CID 102751944
3,5,6-trichloro-N-(3-methylsulfanylbutyl)pyridin-2-amine (PubChem CID 102751944) has the molecular formula C10H13Cl3N2S and a molecular weight of 299.65 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(3-methylsulfanylbutyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(3-methylsulfanylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751944 |
| Molecular Formula | C10H13Cl3N2S |
| Molecular Weight | 299.65 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 3,5,6-trichloro-N-(3-methylsulfanylbutyl)pyridin-2-amine |
| SMILES | CSC(C)CCNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl3N2S/c1-6(16-2)3-4-14-10-8(12)5-7(11)9(13)15-10/h5-6H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | BPKABLPKRHGSAL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|