C10H13Cl3N2OS — CID 106162580
2-methylsulfanyl-3-[(3,5,6-trichloro-2-pyridinyl)amino]butan-1-ol (PubChem CID 106162580) has the molecular formula C10H13Cl3N2OS and a molecular weight of 315.65 g/mol. Its IUPAC name is 2-methylsulfanyl-3-[(3,5,6-trichloro-2-pyridinyl)amino]butan-1-ol.
| Compound Name | 2-methylsulfanyl-3-[(3,5,6-trichloro-2-pyridinyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 106162580 |
| Molecular Formula | C10H13Cl3N2OS |
| Molecular Weight | 315.65 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 2-methylsulfanyl-3-[(3,5,6-trichloro-2-pyridinyl)amino]butan-1-ol |
| SMILES | CSC(CO)C(C)Nc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl3N2OS/c1-5(8(4-16)17-2)14-10-7(12)3-6(11)9(13)15-10/h3,5,8,16H,4H2,1-2H3,(H,14,15) |
| InChIKey | KUPHEOYFFKDBLB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|