C11H16ClFN2OS — CID 114151064
3-(2-amino-4-chloro-5-fluoroanilino)-2-methylsulfanylbutan-1-ol (PubChem CID 114151064) has the molecular formula C11H16ClFN2OS and a molecular weight of 278.78 g/mol. Its IUPAC name is 3-(2-amino-4-chloro-5-fluoroanilino)-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-(2-amino-4-chloro-5-fluoroanilino)-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 114151064 |
| Molecular Formula | C11H16ClFN2OS |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-(2-amino-4-chloro-5-fluoroanilino)-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)Nc1cc(F)c(Cl)cc1N |
| InChI | InChI=1S/C11H16ClFN2OS/c1-6(11(5-16)17-2)15-10-4-8(13)7(12)3-9(10)14/h3-4,6,11,15-16H,5,14H2,1-2H3 |
| InChIKey | DKYQFHQACBYKAO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|