C11H17IN2OS — CID 106154806
3-(2-amino-4-iodoanilino)-2-methylsulfanylbutan-1-ol (PubChem CID 106154806) has the molecular formula C11H17IN2OS and a molecular weight of 352.24 g/mol. Its IUPAC name is 3-(2-amino-4-iodoanilino)-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-(2-amino-4-iodoanilino)-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106154806 |
| Molecular Formula | C11H17IN2OS |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 3-(2-amino-4-iodoanilino)-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)Nc1ccc(I)cc1N |
| InChI | InChI=1S/C11H17IN2OS/c1-7(11(6-15)16-2)14-10-4-3-8(12)5-9(10)13/h3-5,7,11,14-15H,6,13H2,1-2H3 |
| InChIKey | IDDXEMBPURJYSD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|