C14H23N3O2S — CID 106155281
3-amino-4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-N,N-dimethylbenzamide (PubChem CID 106155281) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 3-amino-4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 106155281 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-amino-4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-N,N-dimethylbenzamide |
| SMILES | CSC(CO)C(C)Nc1ccc(C(=O)N(C)C)cc1N |
| InChI | InChI=1S/C14H23N3O2S/c1-9(13(8-18)20-4)16-12-6-5-10(7-11(12)15)14(19)17(2)3/h5-7,9,13,16,18H,8,15H2,1-4H3 |
| InChIKey | IKAXPLDTHKYFFA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|