C15H26N4O — CID 82992217
3-amino-4-[4-(dimethylamino)butan-2-ylamino]-N,N-dimethylbenzamide (PubChem CID 82992217) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is 3-amino-4-[4-(dimethylamino)butan-2-ylamino]-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-[4-(dimethylamino)butan-2-ylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 82992217 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 3-amino-4-[4-(dimethylamino)butan-2-ylamino]-N,N-dimethylbenzamide |
| SMILES | CC(CCN(C)C)Nc1ccc(C(=O)N(C)C)cc1N |
| InChI | InChI=1S/C15H26N4O/c1-11(8-9-18(2)3)17-14-7-6-12(10-13(14)16)15(20)19(4)5/h6-7,10-11,17H,8-9,16H2,1-5H3 |
| InChIKey | HBAGBBZZOPQRAP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|