C13H19ClN2O2 — CID 63087477
3-chloro-4-[4-(dimethylamino)butan-2-ylamino]benzoic acid (PubChem CID 63087477) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 3-chloro-4-[4-(dimethylamino)butan-2-ylamino]benzoic acid.
| Compound Name | 3-chloro-4-[4-(dimethylamino)butan-2-ylamino]benzoic acid |
|---|---|
| PubChem CID | 63087477 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-chloro-4-[4-(dimethylamino)butan-2-ylamino]benzoic acid |
| SMILES | CC(CCN(C)C)Nc1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O2/c1-9(6-7-16(2)3)15-12-5-4-10(13(17)18)8-11(12)14/h4-5,8-9,15H,6-7H2,1-3H3,(H,17,18) |
| InChIKey | PPWQAXNMWBTKPJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |