C13H20ClN3O2 — CID 107195173
5-amino-3-chloro-2-[4-(dimethylamino)butan-2-ylamino]benzoic acid (PubChem CID 107195173) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[4-(dimethylamino)butan-2-ylamino]benzoic acid.
| Compound Name | 5-amino-3-chloro-2-[4-(dimethylamino)butan-2-ylamino]benzoic acid |
|---|---|
| PubChem CID | 107195173 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-amino-3-chloro-2-[4-(dimethylamino)butan-2-ylamino]benzoic acid |
| SMILES | CC(CCN(C)C)Nc1c(Cl)cc(N)cc1C(=O)O |
| InChI | InChI=1S/C13H20ClN3O2/c1-8(4-5-17(2)3)16-12-10(13(18)19)6-9(15)7-11(12)14/h6-8,16H,4-5,15H2,1-3H3,(H,18,19) |
| InChIKey | NBNMGOXSOSKFCE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|