C15H24ClN3O2 — CID 107192613
5-amino-3-chloro-2-[2-[di(propan-2-yl)amino]ethylamino]benzoic acid (PubChem CID 107192613) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[2-[di(propan-2-yl)amino]ethylamino]benzoic acid.
| Compound Name | 5-amino-3-chloro-2-[2-[di(propan-2-yl)amino]ethylamino]benzoic acid |
|---|---|
| PubChem CID | 107192613 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 5-amino-3-chloro-2-[2-[di(propan-2-yl)amino]ethylamino]benzoic acid |
| SMILES | CC(C)N(CCNc1c(Cl)cc(N)cc1C(=O)O)C(C)C |
| InChI | InChI=1S/C15H24ClN3O2/c1-9(2)19(10(3)4)6-5-18-14-12(15(20)21)7-11(17)8-13(14)16/h7-10,18H,5-6,17H2,1-4H3,(H,20,21) |
| InChIKey | WHQUAGKKYXDZNW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|