C12H18ClN3O4S — CID 107195950
5-amino-3-chloro-2-[[2-(methanesulfonamido)-2-methylpropyl]amino]benzoic acid (PubChem CID 107195950) has the molecular formula C12H18ClN3O4S and a molecular weight of 335.81 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[[2-(methanesulfonamido)-2-methylpropyl]amino]benzoic acid.
| Compound Name | 5-amino-3-chloro-2-[[2-(methanesulfonamido)-2-methylpropyl]amino]benzoic acid |
|---|---|
| PubChem CID | 107195950 |
| Molecular Formula | C12H18ClN3O4S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 5-amino-3-chloro-2-[[2-(methanesulfonamido)-2-methylpropyl]amino]benzoic acid |
| SMILES | CC(C)(CNc1c(Cl)cc(N)cc1C(=O)O)NS(C)(=O)=O |
| InChI | InChI=1S/C12H18ClN3O4S/c1-12(2,16-21(3,19)20)6-15-10-8(11(17)18)4-7(14)5-9(10)13/h4-5,15-16H,6,14H2,1-3H3,(H,17,18) |
| InChIKey | FBWVWJCISJLIRG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|