C10H14ClN3O4S — CID 106341908
5-amino-3-chloro-2-[2-(methylsulfamoyl)ethylamino]benzoic acid (PubChem CID 106341908) has the molecular formula C10H14ClN3O4S and a molecular weight of 307.76 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[2-(methylsulfamoyl)ethylamino]benzoic acid.
| Compound Name | 5-amino-3-chloro-2-[2-(methylsulfamoyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 106341908 |
| Molecular Formula | C10H14ClN3O4S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 5-amino-3-chloro-2-[2-(methylsulfamoyl)ethylamino]benzoic acid |
| SMILES | CNS(=O)(=O)CCNc1c(Cl)cc(N)cc1C(=O)O |
| InChI | InChI=1S/C10H14ClN3O4S/c1-13-19(17,18)3-2-14-9-7(10(15)16)4-6(12)5-8(9)11/h4-5,13-14H,2-3,12H2,1H3,(H,15,16) |
| InChIKey | CZRAHPXPDLGETN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|