C9H12ClN3O4S — CID 114175613
5-chloro-2-[2-(methylsulfamoyl)ethylamino]pyridine-4-carboxylic acid (PubChem CID 114175613) has the molecular formula C9H12ClN3O4S and a molecular weight of 293.73 g/mol. Its IUPAC name is 5-chloro-2-[2-(methylsulfamoyl)ethylamino]pyridine-4-carboxylic acid.
| Compound Name | 5-chloro-2-[2-(methylsulfamoyl)ethylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114175613 |
| Molecular Formula | C9H12ClN3O4S |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 5-chloro-2-[2-(methylsulfamoyl)ethylamino]pyridine-4-carboxylic acid |
| SMILES | CNS(=O)(=O)CCNc1cc(C(=O)O)c(Cl)cn1 |
| InChI | InChI=1S/C9H12ClN3O4S/c1-11-18(16,17)3-2-12-8-4-6(9(14)15)7(10)5-13-8/h4-5,11H,2-3H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | OBOAXSVRBJWXNW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |