C11H15ClN2O3 — CID 114920020
5-chloro-2-[(4-hydroxy-2-methylbutan-2-yl)amino]pyridine-4-carboxylic acid (PubChem CID 114920020) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. Its IUPAC name is 5-chloro-2-[(4-hydroxy-2-methylbutan-2-yl)amino]pyridine-4-carboxylic acid.
| Compound Name | 5-chloro-2-[(4-hydroxy-2-methylbutan-2-yl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114920020 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 5-chloro-2-[(4-hydroxy-2-methylbutan-2-yl)amino]pyridine-4-carboxylic acid |
| SMILES | CC(C)(CCO)Nc1cc(C(=O)O)c(Cl)cn1 |
| InChI | InChI=1S/C11H15ClN2O3/c1-11(2,3-4-15)14-9-5-7(10(16)17)8(12)6-13-9/h5-6,15H,3-4H2,1-2H3,(H,13,14)(H,16,17) |
| InChIKey | GLZHZMJTAJHTQD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |