C12H18ClN3O3 — CID 114919583
5-chloro-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]pyridine-4-carboxylic acid (PubChem CID 114919583) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is 5-chloro-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]pyridine-4-carboxylic acid.
| Compound Name | 5-chloro-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114919583 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 5-chloro-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]pyridine-4-carboxylic acid |
| SMILES | COCCN(C)CCNc1cc(C(=O)O)c(Cl)cn1 |
| InChI | InChI=1S/C12H18ClN3O3/c1-16(5-6-19-2)4-3-14-11-7-9(12(17)18)10(13)8-15-11/h7-8H,3-6H2,1-2H3,(H,14,15)(H,17,18) |
| InChIKey | GCAOLSPYKJSCPM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |