C11H14ClN3O4 — CID 114919925
5-chloro-2-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid (PubChem CID 114919925) has the molecular formula C11H14ClN3O4 and a molecular weight of 287.70 g/mol. Its IUPAC name is 5-chloro-2-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid.
| Compound Name | 5-chloro-2-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114919925 |
| Molecular Formula | C11H14ClN3O4 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-chloro-2-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid |
| SMILES | COCCNC(=O)CNc1cc(C(=O)O)c(Cl)cn1 |
| InChI | InChI=1S/C11H14ClN3O4/c1-19-3-2-13-10(16)6-15-9-4-7(11(17)18)8(12)5-14-9/h4-5H,2-3,6H2,1H3,(H,13,16)(H,14,15)(H,17,18) |
| InChIKey | VTQJVXXFWHPSRP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|