C13H8ClF3N2O2 — CID 107195694
5-amino-3-chloro-2-(2,3,5-trifluoroanilino)benzoic acid (PubChem CID 107195694) has the molecular formula C13H8ClF3N2O2 and a molecular weight of 316.67 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2,3,5-trifluoroanilino)benzoic acid.
| Compound Name | 5-amino-3-chloro-2-(2,3,5-trifluoroanilino)benzoic acid |
|---|---|
| PubChem CID | 107195694 |
| Molecular Formula | C13H8ClF3N2O2 |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 5-amino-3-chloro-2-(2,3,5-trifluoroanilino)benzoic acid |
| SMILES | Nc1cc(Cl)c(Nc2cc(F)cc(F)c2F)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H8ClF3N2O2/c14-8-4-6(18)3-7(13(20)21)12(8)19-10-2-5(15)1-9(16)11(10)17/h1-4,19H,18H2,(H,20,21) |
| InChIKey | MSCZKXPBMRCSGP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|