C9H13ClN4O3S — CID 107194123
5-amino-3-chloro-2-(2-sulfamoylethylamino)benzamide (PubChem CID 107194123) has the molecular formula C9H13ClN4O3S and a molecular weight of 292.75 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2-sulfamoylethylamino)benzamide.
| Compound Name | 5-amino-3-chloro-2-(2-sulfamoylethylamino)benzamide |
|---|---|
| PubChem CID | 107194123 |
| Molecular Formula | C9H13ClN4O3S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 5-amino-3-chloro-2-(2-sulfamoylethylamino)benzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1NCCS(N)(=O)=O |
| InChI | InChI=1S/C9H13ClN4O3S/c10-7-4-5(11)3-6(9(12)15)8(7)14-1-2-18(13,16)17/h3-4,14H,1-2,11H2,(H2,12,15)(H2,13,16,17) |
| InChIKey | NRIDMTVSFUGUBM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 141.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|