C11H14ClF2N3O2 — CID 114128998
5-amino-3-chloro-2-[2-(2,2-difluoroethoxy)ethylamino]benzamide (PubChem CID 114128998) has the molecular formula C11H14ClF2N3O2 and a molecular weight of 293.70 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[2-(2,2-difluoroethoxy)ethylamino]benzamide.
| Compound Name | 5-amino-3-chloro-2-[2-(2,2-difluoroethoxy)ethylamino]benzamide |
|---|---|
| PubChem CID | 114128998 |
| Molecular Formula | C11H14ClF2N3O2 |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 5-amino-3-chloro-2-[2-(2,2-difluoroethoxy)ethylamino]benzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1NCCOCC(F)F |
| InChI | InChI=1S/C11H14ClF2N3O2/c12-8-4-6(15)3-7(11(16)18)10(8)17-1-2-19-5-9(13)14/h3-4,9,17H,1-2,5,15H2,(H2,16,18) |
| InChIKey | ZESORNPVQZKELL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|