C11H15F2N3O2 — CID 114129004
2-amino-3-[2-(2,2-difluoroethoxy)ethylamino]benzamide (PubChem CID 114129004) has the molecular formula C11H15F2N3O2 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-amino-3-[2-(2,2-difluoroethoxy)ethylamino]benzamide.
| Compound Name | 2-amino-3-[2-(2,2-difluoroethoxy)ethylamino]benzamide |
|---|---|
| PubChem CID | 114129004 |
| Molecular Formula | C11H15F2N3O2 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-amino-3-[2-(2,2-difluoroethoxy)ethylamino]benzamide |
| SMILES | NC(=O)c1cccc(NCCOCC(F)F)c1N |
| InChI | InChI=1S/C11H15F2N3O2/c12-9(13)6-18-5-4-16-8-3-1-2-7(10(8)14)11(15)17/h1-3,9,16H,4-6,14H2,(H2,15,17) |
| InChIKey | MOUGVFHEOSGFSR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|