C14H22N4O — CID 115546016
2-amino-3-(3-pyrrolidin-1-ylpropylamino)benzamide (PubChem CID 115546016) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-amino-3-(3-pyrrolidin-1-ylpropylamino)benzamide.
| Compound Name | 2-amino-3-(3-pyrrolidin-1-ylpropylamino)benzamide |
|---|---|
| PubChem CID | 115546016 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-amino-3-(3-pyrrolidin-1-ylpropylamino)benzamide |
| SMILES | NC(=O)c1cccc(NCCCN2CCCC2)c1N |
| InChI | InChI=1S/C14H22N4O/c15-13-11(14(16)19)5-3-6-12(13)17-7-4-10-18-8-1-2-9-18/h3,5-6,17H,1-2,4,7-10,15H2,(H2,16,19) |
| InChIKey | IACXNKZSPQWEQM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|