C22H26N4O2 — CID 135182843
1,4-diamino-5-(3-piperidin-1-ylpropylamino)anthracene-9,10-dione (PubChem CID 135182843) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1,4-diamino-5-(3-piperidin-1-ylpropylamino)anthracene-9,10-dione.
| Compound Name | 1,4-diamino-5-(3-piperidin-1-ylpropylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 135182843 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1,4-diamino-5-(3-piperidin-1-ylpropylamino)anthracene-9,10-dione |
| SMILES | Nc1ccc(N)c2c1C(=O)c1cccc(NCCCN3CCCCC3)c1C2=O |
| InChI | InChI=1S/C22H26N4O2/c23-15-8-9-16(24)20-19(15)21(27)14-6-4-7-17(18(14)22(20)28)25-10-5-13-26-11-2-1-3-12-26/h4,6-9,25H,1-3,5,10-13,23-24H2 |
| InChIKey | AOKMQMYMHRPTCU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|