C22H24N4O5 — CID 58070737
2-[(5-amino-4,8-dihydroxy-9,10-dioxoanthracen-1-yl)amino]-N-(2-pyrrolidin-1-ylethyl)acetamide (PubChem CID 58070737) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-[(5-amino-4,8-dihydroxy-9,10-dioxoanthracen-1-yl)amino]-N-(2-pyrrolidin-1-ylethyl)acetamide.
| Compound Name | 2-[(5-amino-4,8-dihydroxy-9,10-dioxoanthracen-1-yl)amino]-N-(2-pyrrolidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 58070737 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[(5-amino-4,8-dihydroxy-9,10-dioxoanthracen-1-yl)amino]-N-(2-pyrrolidin-1-ylethyl)acetamide |
| SMILES | Nc1ccc(O)c2c1C(=O)c1c(O)ccc(NCC(=O)NCCN3CCCC3)c1C2=O |
| InChI | InChI=1S/C22H24N4O5/c23-12-3-5-14(27)19-17(12)21(30)20-15(28)6-4-13(18(20)22(19)31)25-11-16(29)24-7-10-26-8-1-2-9-26/h3-6,25,27-28H,1-2,7-11,23H2,(H,24,29) |
| InChIKey | OXPOFYPKKAQONM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|