C16H15N3O4 — CID 57036046
1-amino-4-(2-aminoethylamino)-5,8-dihydroxyanthracene-9,10-dione (PubChem CID 57036046) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-amino-4-(2-aminoethylamino)-5,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 1-amino-4-(2-aminoethylamino)-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 57036046 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-amino-4-(2-aminoethylamino)-5,8-dihydroxyanthracene-9,10-dione |
| SMILES | NCCNc1ccc(N)c2c1C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C16H15N3O4/c17-5-6-19-8-2-1-7(18)11-12(8)16(23)14-10(21)4-3-9(20)13(14)15(11)22/h1-4,19-21H,5-6,17-18H2 |
| InChIKey | JTDXQLYHYZXDJJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|