C24H22N2O8 — CID 54442571
2-[[4,8-dihydroxy-9,10-dioxo-5-(2-prop-2-enoyloxyethylamino)anthracen-1-yl]amino]ethyl prop-2-enoate (PubChem CID 54442571) has the molecular formula C24H22N2O8 and a molecular weight of 466.45 g/mol. Its IUPAC name is 2-[[4,8-dihydroxy-9,10-dioxo-5-(2-prop-2-enoyloxyethylamino)anthracen-1-yl]amino]ethyl prop-2-enoate.
| Compound Name | 2-[[4,8-dihydroxy-9,10-dioxo-5-(2-prop-2-enoyloxyethylamino)anthracen-1-yl]amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 54442571 |
| Molecular Formula | C24H22N2O8 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[[4,8-dihydroxy-9,10-dioxo-5-(2-prop-2-enoyloxyethylamino)anthracen-1-yl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNc1ccc(O)c2c1C(=O)c1c(O)ccc(NCCOC(=O)C=C)c1C2=O |
| InChI | InChI=1S/C24H22N2O8/c1-3-17(29)33-11-9-25-13-5-7-15(27)21-19(13)23(31)22-16(28)8-6-14(20(22)24(21)32)26-10-12-34-18(30)4-2/h3-8,25-28H,1-2,9-12H2 |
| InChIKey | WPDUCQQXNWKGMX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|