C19H19NO4 — CID 123883482
1-(butylamino)-4,8-dihydroxy-5-methylanthracene-9,10-dione (PubChem CID 123883482) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 1-(butylamino)-4,8-dihydroxy-5-methylanthracene-9,10-dione.
| Compound Name | 1-(butylamino)-4,8-dihydroxy-5-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 123883482 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-(butylamino)-4,8-dihydroxy-5-methylanthracene-9,10-dione |
| SMILES | CCCCNc1ccc(O)c2c1C(=O)c1c(O)ccc(C)c1C2=O |
| InChI | InChI=1S/C19H19NO4/c1-3-4-9-20-11-6-8-13(22)17-15(11)19(24)16-12(21)7-5-10(2)14(16)18(17)23/h5-8,20-22H,3-4,9H2,1-2H3 |
| InChIKey | ZRJFUNYIEJGMMM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|